C25H23F3N2 — CID 174412915
(4R)-4,8-dimethyl-7-(trifluoromethyl)-1,2,3,4-tetrahydrochrysene;pyrazine (PubChem CID 174412915) has the molecular formula C25H23F3N2 and a molecular weight of 408.47 g/mol. Its IUPAC name is (4R)-4,8-dimethyl-7-(trifluoromethyl)-1,2,3,4-tetrahydrochrysene;pyrazine.
| Compound Name | (4R)-4,8-dimethyl-7-(trifluoromethyl)-1,2,3,4-tetrahydrochrysene;pyrazine |
|---|---|
| PubChem CID | 174412915 |
| Molecular Formula | C25H23F3N2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (4R)-4,8-dimethyl-7-(trifluoromethyl)-1,2,3,4-tetrahydrochrysene;pyrazine |
| SMILES | Cc1ccc2c(ccc3c4c(ccc32)CCC[C@H]4C)c1C(F)(F)F.c1cnccn1 |
| InChI | InChI=1S/C21H19F3.C4H4N2/c1-12-4-3-5-14-7-9-15-16-8-6-13(2)20(21(22,23)24)18(16)11-10-17(15)19(12)14;1-2-6-4-3-5-1/h6-12H,3-5H2,1-2H3;1-4H/t12-;/m1./s1 |
| InChIKey | ZGJMHPBNNPJSCA-UTONKHPSSA-N |
| XLogP | 7.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|