About 2-(1-bromoethyl)-3,4-dihydro-2H-pyran
2-(1-bromoethyl)-3,4-dihydro-2H-pyran (PubChem CID 174413074) has the molecular formula C7H11BrO
and a molecular weight of 191.07 g/mol. Its IUPAC name is 2-(1-bromoethyl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2-(1-bromoethyl)-3,4-dihydro-2H-pyran |
| PubChem CID | 174413074 |
| Molecular Formula | C7H11BrO |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 2-(1-bromoethyl)-3,4-dihydro-2H-pyran |
| SMILES | CC(Br)C1CCC=CO1 |
| InChI | InChI=1S/C7H11BrO/c1-6(8)7-4-2-3-5-9-7/h3,5-7H,2,4H2,1H3 |
| InChIKey | GGGYRDDUFMCFCE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-bromoethyl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bromoethyl)-3,4-dihydro-2H-pyran?
The IUPAC name of 2-(1-bromoethyl)-3,4-dihydro-2H-pyran (CID 174413074) is 2-(1-bromoethyl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2-(1-bromoethyl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 2-(1-bromoethyl)-3,4-dihydro-2H-pyran is CC(Br)C1CCC=CO1.
What is the InChIKey of 2-(1-bromoethyl)-3,4-dihydro-2H-pyran?
The InChIKey is GGGYRDDUFMCFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrO/c1-6(8)7-4-2-3-5-9-7/h3,5-7H,2,4H2,1H3.
What are the key properties of 2-(1-bromoethyl)-3,4-dihydro-2H-pyran?
2-(1-bromoethyl)-3,4-dihydro-2H-pyran has a molecular weight of 191.07 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bromoethyl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 174413074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).