About cyclohexylideneurea;hydrochloride
cyclohexylideneurea;hydrochloride (PubChem CID 174413161) has the molecular formula C7H13ClN2O
and a molecular weight of 176.65 g/mol. Its IUPAC name is cyclohexylideneurea;hydrochloride.
Molecular Properties
| Compound Name | cyclohexylideneurea;hydrochloride |
| PubChem CID | 174413161 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | cyclohexylideneurea;hydrochloride |
| SMILES | Cl.NC(=O)N=C1CCCCC1 |
| InChI | InChI=1S/C7H12N2O.ClH/c8-7(10)9-6-4-2-1-3-5-6;/h1-5H2,(H2,8,10);1H |
| InChIKey | WDHDYMHGDWSFNF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylideneurea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylideneurea;hydrochloride?
The IUPAC name of cyclohexylideneurea;hydrochloride (CID 174413161) is cyclohexylideneurea;hydrochloride.
What is the SMILES notation for cyclohexylideneurea;hydrochloride?
The canonical SMILES for cyclohexylideneurea;hydrochloride is Cl.NC(=O)N=C1CCCCC1.
What is the InChIKey of cyclohexylideneurea;hydrochloride?
The InChIKey is WDHDYMHGDWSFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O.ClH/c8-7(10)9-6-4-2-1-3-5-6;/h1-5H2,(H2,8,10);1H.
What are the key properties of cyclohexylideneurea;hydrochloride?
cyclohexylideneurea;hydrochloride has a molecular weight of 176.65 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylideneurea;hydrochloride is sourced from PubChem (CID 174413161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).