C33H26N2O4 — CID 174413229
isoquinoline-6,7-diol;1-(4-nitrophenyl)-1,2,3,4-tetrahydrochrysene (PubChem CID 174413229) has the molecular formula C33H26N2O4 and a molecular weight of 514.58 g/mol. Its IUPAC name is isoquinoline-6,7-diol;1-(4-nitrophenyl)-1,2,3,4-tetrahydrochrysene.
| Compound Name | isoquinoline-6,7-diol;1-(4-nitrophenyl)-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174413229 |
| Molecular Formula | C33H26N2O4 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | isoquinoline-6,7-diol;1-(4-nitrophenyl)-1,2,3,4-tetrahydrochrysene |
| SMILES | O=[N+]([O-])c1ccc(C2CCCc3c2ccc2c3ccc3ccccc32)cc1.Oc1cc2ccncc2cc1O |
| InChI | InChI=1S/C24H19NO2.C9H7NO2/c26-25(27)18-11-8-17(9-12-18)20-6-3-7-21-22(20)14-15-23-19-5-2-1-4-16(19)10-13-24(21)23;11-8-3-6-1-2-10-5-7(6)4-9(8)12/h1-2,4-5,8-15,20H,3,6-7H2;1-5,11-12H |
| InChIKey | VWDJJTPXWCOPQX-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|