C19H22ClNO6S — CID 174413637
ethyl 2-chloro-3-(4,4-dimethyl-2,6-dioxocyclohexanecarbonyl)-6-methylsulfonylbenzenecarboximidate (PubChem CID 174413637) has the molecular formula C19H22ClNO6S and a molecular weight of 427.91 g/mol. Its IUPAC name is ethyl 2-chloro-3-(4,4-dimethyl-2,6-dioxocyclohexanecarbonyl)-6-methylsulfonylbenzenecarboximidate.
| Compound Name | ethyl 2-chloro-3-(4,4-dimethyl-2,6-dioxocyclohexanecarbonyl)-6-methylsulfonylbenzenecarboximidate |
|---|---|
| PubChem CID | 174413637 |
| Molecular Formula | C19H22ClNO6S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | ethyl 2-chloro-3-(4,4-dimethyl-2,6-dioxocyclohexanecarbonyl)-6-methylsulfonylbenzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1c(S(C)(=O)=O)ccc(C(=O)C2C(=O)CC(C)(C)CC2=O)c1Cl |
| InChI | InChI=1S/C19H22ClNO6S/c1-5-27-18(21)15-13(28(4,25)26)7-6-10(16(15)20)17(24)14-11(22)8-19(2,3)9-12(14)23/h6-7,14,21H,5,8-9H2,1-4H3/b21-18- |
| InChIKey | RLHQOANOVYLCPM-UZYVYHOESA-N |
| XLogP | 2.86 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|