C21H32O2S — CID 174413668
(8R,9S,10R,13R,14S,17R)-10,13,17-trimethyl-1-methylsulfonyl-2,3,6,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 174413668) has the molecular formula C21H32O2S and a molecular weight of 348.55 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17R)-10,13,17-trimethyl-1-methylsulfonyl-2,3,6,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13R,14S,17R)-10,13,17-trimethyl-1-methylsulfonyl-2,3,6,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 174413668 |
| Molecular Formula | C21H32O2S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (8R,9S,10R,13R,14S,17R)-10,13,17-trimethyl-1-methylsulfonyl-2,3,6,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@@H]1C=C[C@H]2[C@@H]3CCC4=CCCC(S(C)(=O)=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32O2S/c1-14-8-11-17-16-10-9-15-6-5-7-19(24(4,22)23)21(15,3)18(16)12-13-20(14,17)2/h6,8,11,14,16-19H,5,7,9-10,12-13H2,1-4H3/t14-,16+,17+,18+,19?,20-,21+/m1/s1 |
| InChIKey | RWBXCWZXKBWYLD-UXVNRTJJSA-N |
| XLogP | 4.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|