About propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate
propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate (PubChem CID 174413774) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate.
Analyze propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
The IUPAC name of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate (CID 174413774) is propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate.
What is the SMILES notation for propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
The canonical SMILES for propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate is CCCCC(CC)(CC(C)C)C(C)(C)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
The InChIKey is LXXXQBLHHQPCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-9-11-12-18(10-2,13-14(3)4)17(7,8)16(19)20-15(5)6/h14-15H,9-13H2,1-8H3.
What are the key properties of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate has a molecular weight of 284.48 g/mol, XLogP of 5.60, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate is sourced from PubChem (CID 174413774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).