propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate

C18H36O2 — CID 174413774

IUPACpropan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate
SMILESCCCCC(CC)(CC(C)C)C(C)(C)C(=O)OC(C)C
InChIInChI=1S/C18H36O2/c1-9-11-12-18(10-2,13-14(3)4)17(7,8)16(19)20-15(5)6/h14-15H,9-13H2,1-8H3
InChIKeyLXXXQBLHHQPCEK-UHFFFAOYSA-N
MW284.48 g/mol
LogP5.60
Rot. Bonds9

About propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate

propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate (PubChem CID 174413774) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate.

Molecular Properties

Compound Namepropan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate
PubChem CID174413774
Molecular FormulaC18H36O2
Molecular Weight284.48 g/mol
Exact Mass284.27
IUPAC Namepropan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate
SMILESCCCCC(CC)(CC(C)C)C(C)(C)C(=O)OC(C)C
InChIInChI=1S/C18H36O2/c1-9-11-12-18(10-2,13-14(3)4)17(7,8)16(19)20-15(5)6/h14-15H,9-13H2,1-8H3
InChIKeyLXXXQBLHHQPCEK-UHFFFAOYSA-N
XLogP5.60
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500284.48
LogP ≤ 55.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
The IUPAC name of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate (CID 174413774) is propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate.
What is the SMILES notation for propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
The canonical SMILES for propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate is CCCCC(CC)(CC(C)C)C(C)(C)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
The InChIKey is LXXXQBLHHQPCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-9-11-12-18(10-2,13-14(3)4)17(7,8)16(19)20-15(5)6/h14-15H,9-13H2,1-8H3.
What are the key properties of propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate?
propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate has a molecular weight of 284.48 g/mol, XLogP of 5.60, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-ethyl-2,2-dimethyl-3-(2-methylpropyl)heptanoate is sourced from PubChem (CID 174413774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).