About 3,4-dihydronaphthalene-2-carbaldehyde;hydron
3,4-dihydronaphthalene-2-carbaldehyde;hydron (PubChem CID 174414426) has the molecular formula C11H11O+
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3,4-dihydronaphthalene-2-carbaldehyde;hydron.
Molecular Properties
| Compound Name | 3,4-dihydronaphthalene-2-carbaldehyde;hydron |
| PubChem CID | 174414426 |
| Molecular Formula | C11H11O+ |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 3,4-dihydronaphthalene-2-carbaldehyde;hydron |
| SMILES | O=CC1=Cc2ccccc2CC1.[H+] |
| InChI | InChI=1S/C11H10O/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-4,7-8H,5-6H2/p+1 |
| InChIKey | MMKNAQOTHPHFHG-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydronaphthalene-2-carbaldehyde;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydronaphthalene-2-carbaldehyde;hydron?
The IUPAC name of 3,4-dihydronaphthalene-2-carbaldehyde;hydron (CID 174414426) is 3,4-dihydronaphthalene-2-carbaldehyde;hydron.
What is the SMILES notation for 3,4-dihydronaphthalene-2-carbaldehyde;hydron?
The canonical SMILES for 3,4-dihydronaphthalene-2-carbaldehyde;hydron is O=CC1=Cc2ccccc2CC1.[H+].
What is the InChIKey of 3,4-dihydronaphthalene-2-carbaldehyde;hydron?
The InChIKey is MMKNAQOTHPHFHG-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H10O/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-4,7-8H,5-6H2/p+1.
What are the key properties of 3,4-dihydronaphthalene-2-carbaldehyde;hydron?
3,4-dihydronaphthalene-2-carbaldehyde;hydron has a molecular weight of 159.21 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydronaphthalene-2-carbaldehyde;hydron is sourced from PubChem (CID 174414426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).