About N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine
N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine (PubChem CID 174414714) has the molecular formula C12H17N5O2S
and a molecular weight of 295.37 g/mol. Its IUPAC name is N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine |
| PubChem CID | 174414714 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine |
| SMILES | CC(=O)NCc1occc1C.NC(N)=Nc1nccs1 |
| InChI | InChI=1S/C8H11NO2.C4H6N4S/c1-6-3-4-11-8(6)5-9-7(2)10;5-3(6)8-4-7-1-2-9-4/h3-4H,5H2,1-2H3,(H,9,10);1-2H,(H4,5,6,7,8) |
| InChIKey | ABICALNGOHRSIF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine?
The IUPAC name of N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine (CID 174414714) is N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine?
The canonical SMILES for N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine is CC(=O)NCc1occc1C.NC(N)=Nc1nccs1.
What is the InChIKey of N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine?
The InChIKey is ABICALNGOHRSIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.C4H6N4S/c1-6-3-4-11-8(6)5-9-7(2)10;5-3(6)8-4-7-1-2-9-4/h3-4H,5H2,1-2H3,(H,9,10);1-2H,(H4,5,6,7,8).
What are the key properties of N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine?
N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine has a molecular weight of 295.37 g/mol, XLogP of 1.27, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methylfuran-2-yl)methyl]acetamide;2-(1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 174414714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).