About 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine
6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine (PubChem CID 174415109) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine.
Molecular Properties
| Compound Name | 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine |
| PubChem CID | 174415109 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine |
| SMILES | CC(C)NN.c1cc2cc(c1)OC2 |
| InChI | InChI=1S/C7H6O.C3H10N2/c1-2-6-4-7(3-1)8-5-6;1-3(2)5-4/h1-4H,5H2;3,5H,4H2,1-2H3 |
| InChIKey | UBCUPQYNTOCOGH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine?
The IUPAC name of 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine (CID 174415109) is 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine.
What is the SMILES notation for 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine?
The canonical SMILES for 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine is CC(C)NN.c1cc2cc(c1)OC2.
What is the InChIKey of 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine?
The InChIKey is UBCUPQYNTOCOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C3H10N2/c1-2-6-4-7(3-1)8-5-6;1-3(2)5-4/h1-4H,5H2;3,5H,4H2,1-2H3.
What are the key properties of 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine?
6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine has a molecular weight of 180.25 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxabicyclo[3.2.1]octa-1(8),2,4-triene;propan-2-ylhydrazine is sourced from PubChem (CID 174415109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).