About (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol
(7-ethyl-5,6-dihydronaphthalen-2-yl)methanol (PubChem CID 174415170) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol.
Molecular Properties
| Compound Name | (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol |
| PubChem CID | 174415170 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol |
| SMILES | CCC1=Cc2cc(CO)ccc2CC1 |
| InChI | InChI=1S/C13H16O/c1-2-10-3-5-12-6-4-11(9-14)8-13(12)7-10/h4,6-8,14H,2-3,5,9H2,1H3 |
| InChIKey | RGSXBNWBDZSFON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol?
The IUPAC name of (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol (CID 174415170) is (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol.
What is the SMILES notation for (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol?
The canonical SMILES for (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol is CCC1=Cc2cc(CO)ccc2CC1.
What is the InChIKey of (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol?
The InChIKey is RGSXBNWBDZSFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-2-10-3-5-12-6-4-11(9-14)8-13(12)7-10/h4,6-8,14H,2-3,5,9H2,1H3.
What are the key properties of (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol?
(7-ethyl-5,6-dihydronaphthalen-2-yl)methanol has a molecular weight of 188.27 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-5,6-dihydronaphthalen-2-yl)methanol is sourced from PubChem (CID 174415170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).