About (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate
(1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate (PubChem CID 174415590) has the molecular formula C9H8O5
and a molecular weight of 196.16 g/mol. Its IUPAC name is (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate.
Molecular Properties
| Compound Name | (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate |
| PubChem CID | 174415590 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate |
| SMILES | O=COc1ccc2c(c1)C(O)OC2O |
| InChI | InChI=1S/C9H8O5/c10-4-13-5-1-2-6-7(3-5)9(12)14-8(6)11/h1-4,8-9,11-12H |
| InChIKey | NMEUJUASNFJWMC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate?
The IUPAC name of (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate (CID 174415590) is (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate.
What is the SMILES notation for (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate?
The canonical SMILES for (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate is O=COc1ccc2c(c1)C(O)OC2O.
What is the InChIKey of (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate?
The InChIKey is NMEUJUASNFJWMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O5/c10-4-13-5-1-2-6-7(3-5)9(12)14-8(6)11/h1-4,8-9,11-12H.
What are the key properties of (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate?
(1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate has a molecular weight of 196.16 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl) formate is sourced from PubChem (CID 174415590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).