C27H25F3N4O2 — CID 174415702
N-[(3S)-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-[[2-(2,4,5-trifluorophenyl)acetyl]amino]propanamide (PubChem CID 174415702) has the molecular formula C27H25F3N4O2 and a molecular weight of 494.52 g/mol. Its IUPAC name is N-[(3S)-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-[[2-(2,4,5-trifluorophenyl)acetyl]amino]propanamide.
| Compound Name | N-[(3S)-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-[[2-(2,4,5-trifluorophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 174415702 |
| Molecular Formula | C27H25F3N4O2 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[(3S)-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-[[2-(2,4,5-trifluorophenyl)acetyl]amino]propanamide |
| SMILES | CC(NC(=O)Cc1cc(F)c(F)cc1F)C(=O)N[C@@H]1CN(C)c2ccccc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C27H25F3N4O2/c1-16(31-25(35)13-18-12-21(29)22(30)14-20(18)28)27(36)33-24-15-34(2)23-11-7-6-10-19(23)26(32-24)17-8-4-3-5-9-17/h3-12,14,16,24H,13,15H2,1-2H3,(H,31,35)(H,33,36)/t16?,24-/m1/s1 |
| InChIKey | SGLWTWYDGRBTAU-OODIQHKMSA-N |
| XLogP | 3.58 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|