About 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine
5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine (PubChem CID 174416816) has the molecular formula C16H16FN3
and a molecular weight of 269.32 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine.
Molecular Properties
| Compound Name | 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine |
| PubChem CID | 174416816 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine |
| SMILES | CN1CC(N)N=C(c2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C16H16FN3/c1-20-10-15(18)19-16(11-5-4-6-12(17)9-11)13-7-2-3-8-14(13)20/h2-9,15H,10,18H2,1H3 |
| InChIKey | LUDWLKVFAYVGFC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine?
The IUPAC name of 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine (CID 174416816) is 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine.
What is the SMILES notation for 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine?
The canonical SMILES for 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine is CN1CC(N)N=C(c2cccc(F)c2)c2ccccc21.
What is the InChIKey of 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine?
The InChIKey is LUDWLKVFAYVGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3/c1-20-10-15(18)19-16(11-5-4-6-12(17)9-11)13-7-2-3-8-14(13)20/h2-9,15H,10,18H2,1H3.
What are the key properties of 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine?
5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine has a molecular weight of 269.32 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenyl)-1-methyl-2,3-dihydro-1,4-benzodiazepin-3-amine is sourced from PubChem (CID 174416816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).