About (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid
(4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid (PubChem CID 174417095) has the molecular formula C17H15AsClN3O7S
and a molecular weight of 515.76 g/mol. Its IUPAC name is (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid |
| PubChem CID | 174417095 |
| Molecular Formula | C17H15AsClN3O7S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)OO)cc1.O=C(O)c1nc(-c2nccs2)ccc1Cl |
| InChI | InChI=1S/C9H5ClN2O2S.C8H10AsNO5/c10-5-1-2-6(8-11-3-4-15-8)12-7(5)9(13)14;1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14/h1-4H,(H,13,14);2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | SJKZYPIXYDVNRS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 158.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid?
The IUPAC name of (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid (CID 174417095) is (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid.
What is the SMILES notation for (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid?
The canonical SMILES for (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid is CC(=O)Nc1ccc([As](=O)(O)OO)cc1.O=C(O)c1nc(-c2nccs2)ccc1Cl.
What is the InChIKey of (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid?
The InChIKey is SJKZYPIXYDVNRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O2S.C8H10AsNO5/c10-5-1-2-6(8-11-3-4-15-8)12-7(5)9(13)14;1-6(11)10-8-4-2-7(3-5-8)9(12,13)15-14/h1-4H,(H,13,14);2-5,14H,1H3,(H,10,11)(H,12,13).
What are the key properties of (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid?
(4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid has a molecular weight of 515.76 g/mol, XLogP of 2.26, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl)-hydroperoxyarsinic acid;3-chloro-6-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid is sourced from PubChem (CID 174417095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).