About sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride
sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride (PubChem CID 174417342) has the molecular formula C16H32N3NaO3
and a molecular weight of 337.44 g/mol. Its IUPAC name is sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride.
Molecular Properties
| Compound Name | sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride |
| PubChem CID | 174417342 |
| Molecular Formula | C16H32N3NaO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride |
| SMILES | [H-].[H]/N=C(\N)N(C)CC(=O)OC(=O)CCCCCCCCCCC.[Na+] |
| InChI | InChI=1S/C16H31N3O3.Na.H/c1-3-4-5-6-7-8-9-10-11-12-14(20)22-15(21)13-19(2)16(17)18;;/h3-13H2,1-2H3,(H3,17,18);;/q;+1;-1 |
| InChIKey | SRECOLDTRLMGNS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride?
The IUPAC name of sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride (CID 174417342) is sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride.
What is the SMILES notation for sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride?
The canonical SMILES for sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride is [H-].[H]/N=C(\N)N(C)CC(=O)OC(=O)CCCCCCCCCCC.[Na+].
What is the InChIKey of sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride?
The InChIKey is SRECOLDTRLMGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O3.Na.H/c1-3-4-5-6-7-8-9-10-11-12-14(20)22-15(21)13-19(2)16(17)18;;/h3-13H2,1-2H3,(H3,17,18);;/q;+1;-1.
What are the key properties of sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride?
sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride has a molecular weight of 337.44 g/mol, XLogP of -0.08, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;[2-[carbamimidoyl(methyl)amino]acetyl] dodecanoate;hydride is sourced from PubChem (CID 174417342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).