About (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid
(2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid (PubChem CID 174417587) has the molecular formula C14H17AsN2O9S
and a molecular weight of 464.28 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid.
Molecular Properties
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid |
| PubChem CID | 174417587 |
| Molecular Formula | C14H17AsN2O9S |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.Nc1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C8H10AsNO5.C6H7NO4S/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;7-5-3-4(12(9,10)11)1-2-6(5)8/h2-5,14H,1H3,(H,10,11)(H,12,13);1-3,8H,7H2,(H,9,10,11) |
| InChIKey | DFLWJZDTIBJLCJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid?
The IUPAC name of (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid (CID 174417587) is (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid.
What is the SMILES notation for (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid?
The canonical SMILES for (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid is CC(=O)Nc1ccccc1[As](=O)(O)OO.Nc1cc(S(=O)(=O)O)ccc1O.
What is the InChIKey of (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid?
The InChIKey is DFLWJZDTIBJLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10AsNO5.C6H7NO4S/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;7-5-3-4(12(9,10)11)1-2-6(5)8/h2-5,14H,1H3,(H,10,11)(H,12,13);1-3,8H,7H2,(H,9,10,11).
What are the key properties of (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid?
(2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid has a molecular weight of 464.28 g/mol, XLogP of -0.08, 4 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidophenyl)-hydroperoxyarsinic acid;3-amino-4-hydroxybenzenesulfonic acid is sourced from PubChem (CID 174417587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).