About 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene
1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (PubChem CID 174417666) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
Molecular Properties
| Compound Name | 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| PubChem CID | 174417666 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene |
| SMILES | CCCBr.c1cc2cc(c1)OC2 |
| InChI | InChI=1S/C7H6O.C3H7Br/c1-2-6-4-7(3-1)8-5-6;1-2-3-4/h1-4H,5H2;2-3H2,1H3 |
| InChIKey | DPSSDOGGNIZOSH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
The IUPAC name of 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene (CID 174417666) is 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene.
What is the SMILES notation for 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
The canonical SMILES for 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene is CCCBr.c1cc2cc(c1)OC2.
What is the InChIKey of 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
The InChIKey is DPSSDOGGNIZOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C3H7Br/c1-2-6-4-7(3-1)8-5-6;1-2-3-4/h1-4H,5H2;2-3H2,1H3.
What are the key properties of 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene?
1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene has a molecular weight of 229.12 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropane;6-oxabicyclo[3.2.1]octa-1(8),2,4-triene is sourced from PubChem (CID 174417666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).