About nitrous acid;4-(2H-pyridin-1-yl)aniline
nitrous acid;4-(2H-pyridin-1-yl)aniline (PubChem CID 174418053) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is nitrous acid;4-(2H-pyridin-1-yl)aniline.
Molecular Properties
| Compound Name | nitrous acid;4-(2H-pyridin-1-yl)aniline |
| PubChem CID | 174418053 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | nitrous acid;4-(2H-pyridin-1-yl)aniline |
| SMILES | Nc1ccc(N2C=CC=CC2)cc1.O=NO |
| InChI | InChI=1S/C11H12N2.HNO2/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13;2-1-3/h1-8H,9,12H2;(H,2,3) |
| InChIKey | PPPFASDVVSOGFS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrous acid;4-(2H-pyridin-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrous acid;4-(2H-pyridin-1-yl)aniline?
The IUPAC name of nitrous acid;4-(2H-pyridin-1-yl)aniline (CID 174418053) is nitrous acid;4-(2H-pyridin-1-yl)aniline.
What is the SMILES notation for nitrous acid;4-(2H-pyridin-1-yl)aniline?
The canonical SMILES for nitrous acid;4-(2H-pyridin-1-yl)aniline is Nc1ccc(N2C=CC=CC2)cc1.O=NO.
What is the InChIKey of nitrous acid;4-(2H-pyridin-1-yl)aniline?
The InChIKey is PPPFASDVVSOGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.HNO2/c12-10-4-6-11(7-5-10)13-8-2-1-3-9-13;2-1-3/h1-8H,9,12H2;(H,2,3).
What are the key properties of nitrous acid;4-(2H-pyridin-1-yl)aniline?
nitrous acid;4-(2H-pyridin-1-yl)aniline has a molecular weight of 219.24 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrous acid;4-(2H-pyridin-1-yl)aniline is sourced from PubChem (CID 174418053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).