About pentyl 4-pentoxybut-3-enoate
pentyl 4-pentoxybut-3-enoate (PubChem CID 174418136) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is pentyl 4-pentoxybut-3-enoate.
Molecular Properties
| Compound Name | pentyl 4-pentoxybut-3-enoate |
| PubChem CID | 174418136 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | pentyl 4-pentoxybut-3-enoate |
| SMILES | CCCCCOC=CCC(=O)OCCCCC |
| InChI | InChI=1S/C14H26O3/c1-3-5-7-11-16-12-9-10-14(15)17-13-8-6-4-2/h9,12H,3-8,10-11,13H2,1-2H3 |
| InChIKey | TXHJNMJXNFEZFG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl 4-pentoxybut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 4-pentoxybut-3-enoate?
The IUPAC name of pentyl 4-pentoxybut-3-enoate (CID 174418136) is pentyl 4-pentoxybut-3-enoate.
What is the SMILES notation for pentyl 4-pentoxybut-3-enoate?
The canonical SMILES for pentyl 4-pentoxybut-3-enoate is CCCCCOC=CCC(=O)OCCCCC.
What is the InChIKey of pentyl 4-pentoxybut-3-enoate?
The InChIKey is TXHJNMJXNFEZFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-3-5-7-11-16-12-9-10-14(15)17-13-8-6-4-2/h9,12H,3-8,10-11,13H2,1-2H3.
What are the key properties of pentyl 4-pentoxybut-3-enoate?
pentyl 4-pentoxybut-3-enoate has a molecular weight of 242.36 g/mol, XLogP of 3.83, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 4-pentoxybut-3-enoate is sourced from PubChem (CID 174418136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).