C21H22F2N2O4 — CID 174418138
2-[2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoylamino]-4-phenylbutanoic acid (PubChem CID 174418138) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-[2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoylamino]-4-phenylbutanoic acid.
| Compound Name | 2-[2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoylamino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 174418138 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoylamino]-4-phenylbutanoic acid |
| SMILES | CC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)NC(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H22F2N2O4/c1-13(24-19(26)11-15-9-16(22)12-17(23)10-15)20(27)25-18(21(28)29)8-7-14-5-3-2-4-6-14/h2-6,9-10,12-13,18H,7-8,11H2,1H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | VBQMQFNHVCPEBE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |