C20H22N3O3S2- — CID 174418560
[4-[3-[(4-aminophenyl)methyl]-6-ethyl-2-formyl-2,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfinate (PubChem CID 174418560) has the molecular formula C20H22N3O3S2- and a molecular weight of 416.55 g/mol. Its IUPAC name is [4-[3-[(4-aminophenyl)methyl]-6-ethyl-2-formyl-2,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfinate.
| Compound Name | [4-[3-[(4-aminophenyl)methyl]-6-ethyl-2-formyl-2,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174418560 |
| Molecular Formula | C20H22N3O3S2- |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [4-[3-[(4-aminophenyl)methyl]-6-ethyl-2-formyl-2,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfinate |
| SMILES | CCC1SC(C=O)N(Cc2ccc(N)cc2)N=C1c1ccc(CS(=O)[O-])cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-2-18-20(16-7-3-15(4-8-16)13-28(25)26)22-23(19(12-24)27-18)11-14-5-9-17(21)10-6-14/h3-10,12,18-19H,2,11,13,21H2,1H3,(H,25,26)/p-1 |
| InChIKey | WUFSHVBCZQCMIM-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|