About 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate
1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate (PubChem CID 174418589) has the molecular formula C14H17BrO4
and a molecular weight of 329.19 g/mol. Its IUPAC name is 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate.
Molecular Properties
| Compound Name | 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate |
| PubChem CID | 174418589 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)C(=O)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrO4/c1-3-12(13(16)18-4-2)14(17)19-9-10-5-7-11(15)8-6-10/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | WIEGXXZIRBFAIW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate?
The IUPAC name of 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate (CID 174418589) is 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate.
What is the SMILES notation for 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate?
The canonical SMILES for 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate is CCOC(=O)C(CC)C(=O)OCc1ccc(Br)cc1.
What is the InChIKey of 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate?
The InChIKey is WIEGXXZIRBFAIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrO4/c1-3-12(13(16)18-4-2)14(17)19-9-10-5-7-11(15)8-6-10/h5-8,12H,3-4,9H2,1-2H3.
What are the key properties of 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate?
1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate has a molecular weight of 329.19 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(4-bromophenyl)methyl] 3-O-ethyl 2-ethylpropanedioate is sourced from PubChem (CID 174418589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).