C19H13F3O3 — CID 174418680
2-[2-[4-(trifluoromethyl)phenoxy]phenyl]benzene-1,4-diol (PubChem CID 174418680) has the molecular formula C19H13F3O3 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenoxy]phenyl]benzene-1,4-diol.
| Compound Name | 2-[2-[4-(trifluoromethyl)phenoxy]phenyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 174418680 |
| Molecular Formula | C19H13F3O3 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenoxy]phenyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2ccccc2Oc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H13F3O3/c20-19(21,22)12-5-8-14(9-6-12)25-18-4-2-1-3-15(18)16-11-13(23)7-10-17(16)24/h1-11,23-24H |
| InChIKey | SRTPIKCJMWCRQK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|