About 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane
2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane (PubChem CID 174418794) has the molecular formula C23H22F3O2P
and a molecular weight of 418.40 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane.
Molecular Properties
| Compound Name | 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane |
| PubChem CID | 174418794 |
| Molecular Formula | C23H22F3O2P |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1P(c1ccccc1C)c1ccccc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21P.C2HF3O2/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;3-2(4,5)1(6)7/h4-15H,1-3H3;(H,6,7) |
| InChIKey | KZYOSLLMJAAEPV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane?
The IUPAC name of 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane (CID 174418794) is 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane.
What is the SMILES notation for 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane?
The canonical SMILES for 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane is Cc1ccccc1P(c1ccccc1C)c1ccccc1C.O=C(O)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane?
The InChIKey is KZYOSLLMJAAEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21P.C2HF3O2/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3;3-2(4,5)1(6)7/h4-15H,1-3H3;(H,6,7).
What are the key properties of 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane?
2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane has a molecular weight of 418.40 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroacetic acid;tris(2-methylphenyl)phosphane is sourced from PubChem (CID 174418794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).