C13H9F13 — CID 174418847
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-1-ene (PubChem CID 174418847) has the molecular formula C13H9F13 and a molecular weight of 412.19 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-1-ene.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-1-ene |
|---|---|
| PubChem CID | 174418847 |
| Molecular Formula | C13H9F13 |
| Molecular Weight | 412.19 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]hept-1-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1=C2CCC(C2)C1 |
| InChI | InChI=1S/C13H9F13/c14-8(15,7-4-5-1-2-6(7)3-5)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h5H,1-4H2 |
| InChIKey | IHNAXRANNSMSKY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.19 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|