About 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole
5-(3,5-difluorothiophen-2-yl)-1H-pyrazole (PubChem CID 174420368) has the molecular formula C7H4F2N2S
and a molecular weight of 186.19 g/mol. Its IUPAC name is 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole |
| PubChem CID | 174420368 |
| Molecular Formula | C7H4F2N2S |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole |
| SMILES | Fc1cc(F)c(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C7H4F2N2S/c8-4-3-6(9)12-7(4)5-1-2-10-11-5/h1-3H,(H,10,11) |
| InChIKey | XMHDCNTZFYRDPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole?
The IUPAC name of 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole (CID 174420368) is 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole.
What is the SMILES notation for 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole?
The canonical SMILES for 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole is Fc1cc(F)c(-c2ccn[nH]2)s1.
What is the InChIKey of 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole?
The InChIKey is XMHDCNTZFYRDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2N2S/c8-4-3-6(9)12-7(4)5-1-2-10-11-5/h1-3H,(H,10,11).
What are the key properties of 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole?
5-(3,5-difluorothiophen-2-yl)-1H-pyrazole has a molecular weight of 186.19 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-difluorothiophen-2-yl)-1H-pyrazole is sourced from PubChem (CID 174420368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).