C19H15F3N4O4S2 — CID 17442054
2,2-dioxo-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 17442054) has the molecular formula C19H15F3N4O4S2 and a molecular weight of 484.48 g/mol. Its IUPAC name is 2,2-dioxo-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | 2,2-dioxo-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 17442054 |
| Molecular Formula | C19H15F3N4O4S2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2,2-dioxo-N-[2-(2,2,2-trifluoroethylcarbamoyl)phenyl]-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCC(F)(F)F)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C19H15F3N4O4S2/c20-19(21,22)10-23-17(28)12-3-1-2-4-13(12)24-16(27)11-5-6-14-15(9-11)31-18-25-32(29,30)8-7-26(14)18/h1-6,9H,7-8,10H2,(H,23,28)(H,24,27) |
| InChIKey | HFNADJZQMWMULM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |