About 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde
5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde (PubChem CID 174420807) has the molecular formula C12H20ClNOS
and a molecular weight of 261.82 g/mol. Its IUPAC name is 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde |
| PubChem CID | 174420807 |
| Molecular Formula | C12H20ClNOS |
| Molecular Weight | 261.82 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde |
| SMILES | CCCCCCCCN1SC(Cl)=CC1C=O |
| InChI | InChI=1S/C12H20ClNOS/c1-2-3-4-5-6-7-8-14-11(10-15)9-12(13)16-14/h9-11H,2-8H2,1H3 |
| InChIKey | VJQOHPUBXNAZAG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde?
The IUPAC name of 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde (CID 174420807) is 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde.
What is the SMILES notation for 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde?
The canonical SMILES for 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde is CCCCCCCCN1SC(Cl)=CC1C=O.
What is the InChIKey of 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde?
The InChIKey is VJQOHPUBXNAZAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClNOS/c1-2-3-4-5-6-7-8-14-11(10-15)9-12(13)16-14/h9-11H,2-8H2,1H3.
What are the key properties of 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde?
5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde has a molecular weight of 261.82 g/mol, XLogP of 3.96, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-octyl-3H-1,2-thiazole-3-carbaldehyde is sourced from PubChem (CID 174420807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).