About 6-bromo-1,3-benzothiazole;hydrazine
6-bromo-1,3-benzothiazole;hydrazine (PubChem CID 174420817) has the molecular formula C7H8BrN3S
and a molecular weight of 246.13 g/mol. Its IUPAC name is 6-bromo-1,3-benzothiazole;hydrazine.
Molecular Properties
| Compound Name | 6-bromo-1,3-benzothiazole;hydrazine |
| PubChem CID | 174420817 |
| Molecular Formula | C7H8BrN3S |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 6-bromo-1,3-benzothiazole;hydrazine |
| SMILES | Brc1ccc2ncsc2c1.NN |
| InChI | InChI=1S/C7H4BrNS.H4N2/c8-5-1-2-6-7(3-5)10-4-9-6;1-2/h1-4H;1-2H2 |
| InChIKey | WPVYMJLEMIJENT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,3-benzothiazole;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-benzothiazole;hydrazine?
The IUPAC name of 6-bromo-1,3-benzothiazole;hydrazine (CID 174420817) is 6-bromo-1,3-benzothiazole;hydrazine.
What is the SMILES notation for 6-bromo-1,3-benzothiazole;hydrazine?
The canonical SMILES for 6-bromo-1,3-benzothiazole;hydrazine is Brc1ccc2ncsc2c1.NN.
What is the InChIKey of 6-bromo-1,3-benzothiazole;hydrazine?
The InChIKey is WPVYMJLEMIJENT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNS.H4N2/c8-5-1-2-6-7(3-5)10-4-9-6;1-2/h1-4H;1-2H2.
What are the key properties of 6-bromo-1,3-benzothiazole;hydrazine?
6-bromo-1,3-benzothiazole;hydrazine has a molecular weight of 246.13 g/mol, XLogP of 1.88, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-benzothiazole;hydrazine is sourced from PubChem (CID 174420817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).