C15H23N3O2S — CID 174421472
5-(carbamoylamino)-2-(2,4,6-trimethylanilino)pentanethioic S-acid (PubChem CID 174421472) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-(2,4,6-trimethylanilino)pentanethioic S-acid.
| Compound Name | 5-(carbamoylamino)-2-(2,4,6-trimethylanilino)pentanethioic S-acid |
|---|---|
| PubChem CID | 174421472 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-(carbamoylamino)-2-(2,4,6-trimethylanilino)pentanethioic S-acid |
| SMILES | Cc1cc(C)c(NC(CCCNC(N)=O)C(=O)S)c(C)c1 |
| InChI | InChI=1S/C15H23N3O2S/c1-9-7-10(2)13(11(3)8-9)18-12(14(19)21)5-4-6-17-15(16)20/h7-8,12,18H,4-6H2,1-3H3,(H,19,21)(H3,16,17,20) |
| InChIKey | GNDLBEVIHVDOGX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|