C14H16N2O3 — CID 174421760
1-methyl-3-phenyl-1,3-diazinane-2,4,5-tricarbaldehyde (PubChem CID 174421760) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-methyl-3-phenyl-1,3-diazinane-2,4,5-tricarbaldehyde.
| Compound Name | 1-methyl-3-phenyl-1,3-diazinane-2,4,5-tricarbaldehyde |
|---|---|
| PubChem CID | 174421760 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-methyl-3-phenyl-1,3-diazinane-2,4,5-tricarbaldehyde |
| SMILES | CN1CC(C=O)C(C=O)N(c2ccccc2)C1C=O |
| InChI | InChI=1S/C14H16N2O3/c1-15-7-11(8-17)13(9-18)16(14(15)10-19)12-5-3-2-4-6-12/h2-6,8-11,13-14H,7H2,1H3 |
| InChIKey | UQNUMFYFRYWXTR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|