2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid

C14H25NO4 — CID 174421767

IUPAC2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid
SMILESO=C(O)C1CCCC1.O=C(O)CNC1CCCCC1
InChIInChI=1S/C8H15NO2.C6H10O2/c10-8(11)6-9-7-4-2-1-3-5-7;7-6(8)5-3-1-2-4-5/h7,9H,1-6H2,(H,10,11);5H,1-4H2,(H,7,8)
InChIKeyKHHYQIGUQRYEEI-UHFFFAOYSA-N
MW271.36 g/mol
LogP2.25
Rot. Bonds4

About 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid

2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid (PubChem CID 174421767) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid.

Molecular Properties

Compound Name2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid
PubChem CID174421767
Molecular FormulaC14H25NO4
Molecular Weight271.36 g/mol
Exact Mass271.18
IUPAC Name2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid
SMILESO=C(O)C1CCCC1.O=C(O)CNC1CCCCC1
InChIInChI=1S/C8H15NO2.C6H10O2/c10-8(11)6-9-7-4-2-1-3-5-7;7-6(8)5-3-1-2-4-5/h7,9H,1-6H2,(H,10,11);5H,1-4H2,(H,7,8)
InChIKeyKHHYQIGUQRYEEI-UHFFFAOYSA-N
XLogP2.25
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.36
LogP ≤ 52.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

sodium;2-(cyclohexylamino)acetic acid;hydroxide
CID 164959041
2-(cyclopropylamino)acetic acid
CID 21197388
cyclooctadecane-1,7,13-tricarboxylic acid
CID 10715056
cyclotetracosanecarboxylic acid
CID 176986816
cyclohexanecarboxylic acid
CID 11286469
1-[2-(cyclopentylamino)acetyl]piperidine-3-carboxylic acid
CID 61156810
2-[[2-(cyclopentylamino)acetyl]amino]acetic acid
CID 61158187
2-[(cycloheptylamino)methyl]prop-2-enoic acid
CID 103237247
1-cycloheptyl-2-(cyclopropylamino)ethanone
CID 116555214
cycloheptanecarboxylic acid;indigane
CID 173230239
cyclohexanecarboxylic acid;octahydrate
CID 175413747
cyclohexanecarboxylic acid;trihydrochloride
CID 67185988

Frequently Asked Questions

What is the IUPAC name of 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid?
The IUPAC name of 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid (CID 174421767) is 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid.
What is the SMILES notation for 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid?
The canonical SMILES for 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid is O=C(O)C1CCCC1.O=C(O)CNC1CCCCC1.
What is the InChIKey of 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid?
The InChIKey is KHHYQIGUQRYEEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H10O2/c10-8(11)6-9-7-4-2-1-3-5-7;7-6(8)5-3-1-2-4-5/h7,9H,1-6H2,(H,10,11);5H,1-4H2,(H,7,8).
What are the key properties of 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid?
2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid has a molecular weight of 271.36 g/mol, XLogP of 2.25, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid is sourced from PubChem (CID 174421767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).