C14H25NO4 — CID 174421767
2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid (PubChem CID 174421767) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid.
| Compound Name | 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid |
|---|---|
| PubChem CID | 174421767 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-(cyclohexylamino)acetic acid;cyclopentanecarboxylic acid |
| SMILES | O=C(O)C1CCCC1.O=C(O)CNC1CCCCC1 |
| InChI | InChI=1S/C8H15NO2.C6H10O2/c10-8(11)6-9-7-4-2-1-3-5-7;7-6(8)5-3-1-2-4-5/h7,9H,1-6H2,(H,10,11);5H,1-4H2,(H,7,8) |
| InChIKey | KHHYQIGUQRYEEI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |