About 1-O-ethyl 5-O-(methoxymethyl) pentanedioate
1-O-ethyl 5-O-(methoxymethyl) pentanedioate (PubChem CID 174421826) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-O-ethyl 5-O-(methoxymethyl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-(methoxymethyl) pentanedioate |
| PubChem CID | 174421826 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-O-ethyl 5-O-(methoxymethyl) pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)OCOC |
| InChI | InChI=1S/C9H16O5/c1-3-13-8(10)5-4-6-9(11)14-7-12-2/h3-7H2,1-2H3 |
| InChIKey | IJGHXTXTSPRGQD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-(methoxymethyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-(methoxymethyl) pentanedioate?
The IUPAC name of 1-O-ethyl 5-O-(methoxymethyl) pentanedioate (CID 174421826) is 1-O-ethyl 5-O-(methoxymethyl) pentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-(methoxymethyl) pentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-(methoxymethyl) pentanedioate is CCOC(=O)CCCC(=O)OCOC.
What is the InChIKey of 1-O-ethyl 5-O-(methoxymethyl) pentanedioate?
The InChIKey is IJGHXTXTSPRGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-3-13-8(10)5-4-6-9(11)14-7-12-2/h3-7H2,1-2H3.
What are the key properties of 1-O-ethyl 5-O-(methoxymethyl) pentanedioate?
1-O-ethyl 5-O-(methoxymethyl) pentanedioate has a molecular weight of 204.22 g/mol, XLogP of 0.87, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-(methoxymethyl) pentanedioate is sourced from PubChem (CID 174421826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).