About 5-chloro-1,3-dimethylcyclopenta-1,3-diene
5-chloro-1,3-dimethylcyclopenta-1,3-diene (PubChem CID 174422418) has the molecular formula C7H9Cl
and a molecular weight of 128.60 g/mol. Its IUPAC name is 5-chloro-1,3-dimethylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5-chloro-1,3-dimethylcyclopenta-1,3-diene |
| PubChem CID | 174422418 |
| Molecular Formula | C7H9Cl |
| Molecular Weight | 128.60 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 5-chloro-1,3-dimethylcyclopenta-1,3-diene |
| SMILES | CC1=CC(Cl)C(C)=C1 |
| InChI | InChI=1S/C7H9Cl/c1-5-3-6(2)7(8)4-5/h3-4,7H,1-2H3 |
| InChIKey | LGSFGASBIATKDW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,3-dimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-dimethylcyclopenta-1,3-diene?
The IUPAC name of 5-chloro-1,3-dimethylcyclopenta-1,3-diene (CID 174422418) is 5-chloro-1,3-dimethylcyclopenta-1,3-diene.
What is the SMILES notation for 5-chloro-1,3-dimethylcyclopenta-1,3-diene?
The canonical SMILES for 5-chloro-1,3-dimethylcyclopenta-1,3-diene is CC1=CC(Cl)C(C)=C1.
What is the InChIKey of 5-chloro-1,3-dimethylcyclopenta-1,3-diene?
The InChIKey is LGSFGASBIATKDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl/c1-5-3-6(2)7(8)4-5/h3-4,7H,1-2H3.
What are the key properties of 5-chloro-1,3-dimethylcyclopenta-1,3-diene?
5-chloro-1,3-dimethylcyclopenta-1,3-diene has a molecular weight of 128.60 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-dimethylcyclopenta-1,3-diene is sourced from PubChem (CID 174422418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).