About 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane
4-butyl-3,3-dimethylthiophen-2-one;cyclohexane (PubChem CID 174422542) has the molecular formula C16H28OS
and a molecular weight of 268.47 g/mol. Its IUPAC name is 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane.
Molecular Properties
| Compound Name | 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane |
| PubChem CID | 174422542 |
| Molecular Formula | C16H28OS |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane |
| SMILES | C1CCCCC1.CCCCC1=CSC(=O)C1(C)C |
| InChI | InChI=1S/C10H16OS.C6H12/c1-4-5-6-8-7-12-9(11)10(8,2)3;1-2-4-6-5-3-1/h7H,4-6H2,1-3H3;1-6H2 |
| InChIKey | UKUDIZXIPRGGPD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane?
The IUPAC name of 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane (CID 174422542) is 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane.
What is the SMILES notation for 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane?
The canonical SMILES for 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane is C1CCCCC1.CCCCC1=CSC(=O)C1(C)C.
What is the InChIKey of 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane?
The InChIKey is UKUDIZXIPRGGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16OS.C6H12/c1-4-5-6-8-7-12-9(11)10(8,2)3;1-2-4-6-5-3-1/h7H,4-6H2,1-3H3;1-6H2.
What are the key properties of 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane?
4-butyl-3,3-dimethylthiophen-2-one;cyclohexane has a molecular weight of 268.47 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-3,3-dimethylthiophen-2-one;cyclohexane is sourced from PubChem (CID 174422542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).