About 2-bromo-6-methylthiane
2-bromo-6-methylthiane (PubChem CID 174422605) has the molecular formula C6H11BrS
and a molecular weight of 195.12 g/mol. Its IUPAC name is 2-bromo-6-methylthiane.
Molecular Properties
| Compound Name | 2-bromo-6-methylthiane |
| PubChem CID | 174422605 |
| Molecular Formula | C6H11BrS |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 2-bromo-6-methylthiane |
| SMILES | CC1CCCC(Br)S1 |
| InChI | InChI=1S/C6H11BrS/c1-5-3-2-4-6(7)8-5/h5-6H,2-4H2,1H3 |
| InChIKey | PJUNOJAWQMYBQG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-methylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-methylthiane?
The IUPAC name of 2-bromo-6-methylthiane (CID 174422605) is 2-bromo-6-methylthiane.
What is the SMILES notation for 2-bromo-6-methylthiane?
The canonical SMILES for 2-bromo-6-methylthiane is CC1CCCC(Br)S1.
What is the InChIKey of 2-bromo-6-methylthiane?
The InChIKey is PJUNOJAWQMYBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrS/c1-5-3-2-4-6(7)8-5/h5-6H,2-4H2,1H3.
What are the key properties of 2-bromo-6-methylthiane?
2-bromo-6-methylthiane has a molecular weight of 195.12 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-methylthiane is sourced from PubChem (CID 174422605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).