About 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol
3,4-dimethyl-2,5-dihydrothiophene-2,5-diol (PubChem CID 174422646) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol |
| PubChem CID | 174422646 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol |
| SMILES | CC1=C(C)C(O)SC1O |
| InChI | InChI=1S/C6H10O2S/c1-3-4(2)6(8)9-5(3)7/h5-8H,1-2H3 |
| InChIKey | PYCGWAJPRZNBAA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol?
The IUPAC name of 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol (CID 174422646) is 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol.
What is the SMILES notation for 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol?
The canonical SMILES for 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol is CC1=C(C)C(O)SC1O.
What is the InChIKey of 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol?
The InChIKey is PYCGWAJPRZNBAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-3-4(2)6(8)9-5(3)7/h5-8H,1-2H3.
What are the key properties of 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol?
3,4-dimethyl-2,5-dihydrothiophene-2,5-diol has a molecular weight of 146.21 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-dihydrothiophene-2,5-diol is sourced from PubChem (CID 174422646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).