About but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane
but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane (PubChem CID 174422975) has the molecular formula C15H34O4Si
and a molecular weight of 306.52 g/mol. Its IUPAC name is but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane.
Molecular Properties
| Compound Name | but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane |
| PubChem CID | 174422975 |
| Molecular Formula | C15H34O4Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane |
| SMILES | C=CCC.CCCCCO[SiH2]C(OC)(OC)C(C)OC |
| InChI | InChI=1S/C11H26O4Si.C4H8/c1-6-7-8-9-15-16-11(13-4,14-5)10(2)12-3;1-3-4-2/h10H,6-9,16H2,1-5H3;3H,1,4H2,2H3 |
| InChIKey | SOMLLBKFVUMBKZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane?
The IUPAC name of but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane (CID 174422975) is but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane.
What is the SMILES notation for but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane?
The canonical SMILES for but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane is C=CCC.CCCCCO[SiH2]C(OC)(OC)C(C)OC.
What is the InChIKey of but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane?
The InChIKey is SOMLLBKFVUMBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O4Si.C4H8/c1-6-7-8-9-15-16-11(13-4,14-5)10(2)12-3;1-3-4-2/h10H,6-9,16H2,1-5H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane?
but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane has a molecular weight of 306.52 g/mol, XLogP of 2.84, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;pentoxy(1,1,2-trimethoxypropyl)silane is sourced from PubChem (CID 174422975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).