About (1-ethylpiperidin-4-yl) N-tert-butylcarbamate
(1-ethylpiperidin-4-yl) N-tert-butylcarbamate (PubChem CID 174424226) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl) N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-4-yl) N-tert-butylcarbamate |
| PubChem CID | 174424226 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (1-ethylpiperidin-4-yl) N-tert-butylcarbamate |
| SMILES | CCN1CCC(OC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-5-14-8-6-10(7-9-14)16-11(15)13-12(2,3)4/h10H,5-9H2,1-4H3,(H,13,15) |
| InChIKey | WXADQSHQYPDSNO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylpiperidin-4-yl) N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-4-yl) N-tert-butylcarbamate?
The IUPAC name of (1-ethylpiperidin-4-yl) N-tert-butylcarbamate (CID 174424226) is (1-ethylpiperidin-4-yl) N-tert-butylcarbamate.
What is the SMILES notation for (1-ethylpiperidin-4-yl) N-tert-butylcarbamate?
The canonical SMILES for (1-ethylpiperidin-4-yl) N-tert-butylcarbamate is CCN1CCC(OC(=O)NC(C)(C)C)CC1.
What is the InChIKey of (1-ethylpiperidin-4-yl) N-tert-butylcarbamate?
The InChIKey is WXADQSHQYPDSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-5-14-8-6-10(7-9-14)16-11(15)13-12(2,3)4/h10H,5-9H2,1-4H3,(H,13,15).
What are the key properties of (1-ethylpiperidin-4-yl) N-tert-butylcarbamate?
(1-ethylpiperidin-4-yl) N-tert-butylcarbamate has a molecular weight of 228.34 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-4-yl) N-tert-butylcarbamate is sourced from PubChem (CID 174424226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).