C12H22N2O3 — CID 174424593
N-(1-amino-1-oxopentan-2-yl)-4-hydroxycyclohexane-1-carboxamide (PubChem CID 174424593) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N-(1-amino-1-oxopentan-2-yl)-4-hydroxycyclohexane-1-carboxamide.
| Compound Name | N-(1-amino-1-oxopentan-2-yl)-4-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 174424593 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-(1-amino-1-oxopentan-2-yl)-4-hydroxycyclohexane-1-carboxamide |
| SMILES | CCCC(NC(=O)C1CCC(O)CC1)C(N)=O |
| InChI | InChI=1S/C12H22N2O3/c1-2-3-10(11(13)16)14-12(17)8-4-6-9(15)7-5-8/h8-10,15H,2-7H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | XVYBZEKUJBYZIF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |