C30H19F6NS2 — CID 174425306
4-[3,3,4,4,5,5-hexafluoro-2-[6-(3-methylphenyl)-1-benzothiophen-2-yl]cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole (PubChem CID 174425306) has the molecular formula C30H19F6NS2 and a molecular weight of 571.61 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-[6-(3-methylphenyl)-1-benzothiophen-2-yl]cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-[6-(3-methylphenyl)-1-benzothiophen-2-yl]cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 174425306 |
| Molecular Formula | C30H19F6NS2 |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-[6-(3-methylphenyl)-1-benzothiophen-2-yl]cyclopenten-1-yl]-5-methyl-2-phenyl-1,3-thiazole |
| SMILES | Cc1cccc(-c2ccc3cc(C4=C(c5nc(-c6ccccc6)sc5C)C(F)(F)C(F)(F)C4(F)F)sc3c2)c1 |
| InChI | InChI=1S/C30H19F6NS2/c1-16-7-6-10-19(13-16)20-11-12-21-15-23(39-22(21)14-20)24-25(29(33,34)30(35,36)28(24,31)32)26-17(2)38-27(37-26)18-8-4-3-5-9-18/h3-15H,1-2H3 |
| InChIKey | QXKBCINRWCBGBN-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|