C30H30O5Si — CID 174425558
3-methoxy-1,2,3,6-tetrahydrochrysene;5-trimethylsilyloxy-2-benzofuran-1,3-dione (PubChem CID 174425558) has the molecular formula C30H30O5Si and a molecular weight of 498.65 g/mol. Its IUPAC name is 3-methoxy-1,2,3,6-tetrahydrochrysene;5-trimethylsilyloxy-2-benzofuran-1,3-dione.
| Compound Name | 3-methoxy-1,2,3,6-tetrahydrochrysene;5-trimethylsilyloxy-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 174425558 |
| Molecular Formula | C30H30O5Si |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-methoxy-1,2,3,6-tetrahydrochrysene;5-trimethylsilyloxy-2-benzofuran-1,3-dione |
| SMILES | COC1C=c2c(ccc3c2=CCc2ccccc2-3)CC1.C[Si](C)(C)Oc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C19H18O.C11H12O4Si/c1-20-15-9-6-14-8-10-17-16-5-3-2-4-13(16)7-11-18(17)19(14)12-15;1-16(2,3)15-7-4-5-8-9(6-7)11(13)14-10(8)12/h2-5,8,10-12,15H,6-7,9H2,1H3;4-6H,1-3H3 |
| InChIKey | XXSYIQJFOSZCSQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|