C34H51N2O9S- — CID 174425572
7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-[[(2-methylpropan-2-yl)oxycarbonylamino]-sulfinatoamino]nonyl]-2,4-dihydrochromene (PubChem CID 174425572) has the molecular formula C34H51N2O9S- and a molecular weight of 663.85 g/mol. Its IUPAC name is 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-[[(2-methylpropan-2-yl)oxycarbonylamino]-sulfinatoamino]nonyl]-2,4-dihydrochromene.
| Compound Name | 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-[[(2-methylpropan-2-yl)oxycarbonylamino]-sulfinatoamino]nonyl]-2,4-dihydrochromene |
|---|---|
| PubChem CID | 174425572 |
| Molecular Formula | C34H51N2O9S- |
| Molecular Weight | 663.85 g/mol |
| Exact Mass | 663.33 |
| IUPAC Name | 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-[[(2-methylpropan-2-yl)oxycarbonylamino]-sulfinatoamino]nonyl]-2,4-dihydrochromene |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCCCCCCN(NC(=O)OC(C)(C)C)S(=O)[O-])cc1 |
| InChI | InChI=1S/C34H52N2O9S/c1-33(2,3)45-32(37)35-36(46(38)39)21-13-11-9-7-8-10-12-14-30-29-20-19-28(44-25-41-6)22-31(29)42-23-34(30,4)26-15-17-27(18-16-26)43-24-40-5/h15-20,22,30H,7-14,21,23-25H2,1-6H3,(H,35,37)(H,38,39)/p-1 |
| InChIKey | AOBAQBVQTRNYRF-UHFFFAOYSA-M |
| XLogP | 6.74 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.85 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|