About 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane
3-O-butyl 1-O-ethyl propanedioate;1-chloropentane (PubChem CID 174426420) has the molecular formula C14H27ClO4
and a molecular weight of 294.82 g/mol. Its IUPAC name is 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane.
Molecular Properties
| Compound Name | 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane |
| PubChem CID | 174426420 |
| Molecular Formula | C14H27ClO4 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane |
| SMILES | CCCCCCl.CCCCOC(=O)CC(=O)OCC |
| InChI | InChI=1S/C9H16O4.C5H11Cl/c1-3-5-6-13-9(11)7-8(10)12-4-2;1-2-3-4-5-6/h3-7H2,1-2H3;2-5H2,1H3 |
| InChIKey | ATJOXSMMLDZQCR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane?
The IUPAC name of 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane (CID 174426420) is 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane.
What is the SMILES notation for 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane?
The canonical SMILES for 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane is CCCCCCl.CCCCOC(=O)CC(=O)OCC.
What is the InChIKey of 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane?
The InChIKey is ATJOXSMMLDZQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C5H11Cl/c1-3-5-6-13-9(11)7-8(10)12-4-2;1-2-3-4-5-6/h3-7H2,1-2H3;2-5H2,1H3.
What are the key properties of 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane?
3-O-butyl 1-O-ethyl propanedioate;1-chloropentane has a molecular weight of 294.82 g/mol, XLogP of 3.70, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-butyl 1-O-ethyl propanedioate;1-chloropentane is sourced from PubChem (CID 174426420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).