About 1-fluoroethyl 2-methylidenepentanoate
1-fluoroethyl 2-methylidenepentanoate (PubChem CID 174426494) has the molecular formula C8H13FO2
and a molecular weight of 160.19 g/mol. Its IUPAC name is 1-fluoroethyl 2-methylidenepentanoate.
Molecular Properties
| Compound Name | 1-fluoroethyl 2-methylidenepentanoate |
| PubChem CID | 174426494 |
| Molecular Formula | C8H13FO2 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 1-fluoroethyl 2-methylidenepentanoate |
| SMILES | C=C(CCC)C(=O)OC(C)F |
| InChI | InChI=1S/C8H13FO2/c1-4-5-6(2)8(10)11-7(3)9/h7H,2,4-5H2,1,3H3 |
| InChIKey | JJFKCNUWVWMGKD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroethyl 2-methylidenepentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethyl 2-methylidenepentanoate?
The IUPAC name of 1-fluoroethyl 2-methylidenepentanoate (CID 174426494) is 1-fluoroethyl 2-methylidenepentanoate.
What is the SMILES notation for 1-fluoroethyl 2-methylidenepentanoate?
The canonical SMILES for 1-fluoroethyl 2-methylidenepentanoate is C=C(CCC)C(=O)OC(C)F.
What is the InChIKey of 1-fluoroethyl 2-methylidenepentanoate?
The InChIKey is JJFKCNUWVWMGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FO2/c1-4-5-6(2)8(10)11-7(3)9/h7H,2,4-5H2,1,3H3.
What are the key properties of 1-fluoroethyl 2-methylidenepentanoate?
1-fluoroethyl 2-methylidenepentanoate has a molecular weight of 160.19 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethyl 2-methylidenepentanoate is sourced from PubChem (CID 174426494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).