About 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride
2-aminobutan-2-ol;methanesulfonic acid;hydrochloride (PubChem CID 174426895) has the molecular formula C5H16ClNO4S
and a molecular weight of 221.71 g/mol. Its IUPAC name is 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride |
| PubChem CID | 174426895 |
| Molecular Formula | C5H16ClNO4S |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride |
| SMILES | CCC(C)(N)O.CS(=O)(=O)O.Cl |
| InChI | InChI=1S/C4H11NO.CH4O3S.ClH/c1-3-4(2,5)6;1-5(2,3)4;/h6H,3,5H2,1-2H3;1H3,(H,2,3,4);1H |
| InChIKey | INUIBIACFWZEIK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride?
The IUPAC name of 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride (CID 174426895) is 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride.
What is the SMILES notation for 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride?
The canonical SMILES for 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride is CCC(C)(N)O.CS(=O)(=O)O.Cl.
What is the InChIKey of 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride?
The InChIKey is INUIBIACFWZEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.CH4O3S.ClH/c1-3-4(2,5)6;1-5(2,3)4;/h6H,3,5H2,1-2H3;1H3,(H,2,3,4);1H.
What are the key properties of 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride?
2-aminobutan-2-ol;methanesulfonic acid;hydrochloride has a molecular weight of 221.71 g/mol, XLogP of -0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutan-2-ol;methanesulfonic acid;hydrochloride is sourced from PubChem (CID 174426895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).