C18H19NO5S — CID 174427000
2,2-dimethyl-6-[3-(1,3-thiazol-5-yl)phenyl]-1,3-dioxin-4-one;ethyl formate (PubChem CID 174427000) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is 2,2-dimethyl-6-[3-(1,3-thiazol-5-yl)phenyl]-1,3-dioxin-4-one;ethyl formate.
| Compound Name | 2,2-dimethyl-6-[3-(1,3-thiazol-5-yl)phenyl]-1,3-dioxin-4-one;ethyl formate |
|---|---|
| PubChem CID | 174427000 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2,2-dimethyl-6-[3-(1,3-thiazol-5-yl)phenyl]-1,3-dioxin-4-one;ethyl formate |
| SMILES | CC1(C)OC(=O)C=C(c2cccc(-c3cncs3)c2)O1.CCOC=O |
| InChI | InChI=1S/C15H13NO3S.C3H6O2/c1-15(2)18-12(7-14(17)19-15)10-4-3-5-11(6-10)13-8-16-9-20-13;1-2-5-3-4/h3-9H,1-2H3;3H,2H2,1H3 |
| InChIKey | DJZAIBZUXIZBRB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|