C27H38Cl2N6O — CID 174427330
bis[4-chloro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]methanone (PubChem CID 174427330) has the molecular formula C27H38Cl2N6O and a molecular weight of 533.55 g/mol. Its IUPAC name is bis[4-chloro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]methanone.
| Compound Name | bis[4-chloro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 174427330 |
| Molecular Formula | C27H38Cl2N6O |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | bis[4-chloro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]methanone |
| SMILES | Cc1ccc(CNCC2(Cl)CCN(C(=O)N3CCC(Cl)(CNCc4ccc(C)cn4)CC3)CC2)nc1 |
| InChI | InChI=1S/C27H38Cl2N6O/c1-21-3-5-23(32-15-21)17-30-19-26(28)7-11-34(12-8-26)25(36)35-13-9-27(29,10-14-35)20-31-18-24-6-4-22(2)16-33-24/h3-6,15-16,30-31H,7-14,17-20H2,1-2H3 |
| InChIKey | IPYFMCQWIGXKRW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|