C15H23NO2 — CID 174427521
5-(4-ethyl-3,5-dimethoxyphenyl)pentan-2-imine (PubChem CID 174427521) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-(4-ethyl-3,5-dimethoxyphenyl)pentan-2-imine.
| Compound Name | 5-(4-ethyl-3,5-dimethoxyphenyl)pentan-2-imine |
|---|---|
| PubChem CID | 174427521 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-(4-ethyl-3,5-dimethoxyphenyl)pentan-2-imine |
| SMILES | [H]/N=C(\C)CCCc1cc(OC)c(CC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO2/c1-5-13-14(17-3)9-12(10-15(13)18-4)8-6-7-11(2)16/h9-10,16H,5-8H2,1-4H3/b16-11+ |
| InChIKey | NSACCMZOSGWWJY-LFIBNONCSA-N |
| XLogP | 3.63 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|